CAS 1070879-60-5 appears in our catalog under these names: 4-Bromo-2,6,8-trimethylquinoline, 95%, 4-bromo-2,6,8-trimethylquinoline, 97%, 97%, 4-Bromo-2,6,8-trimethylquinoline. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-bromo-2,6,8-trimethylquinoline (CAS 1070879-60-5) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 4-bromo-2,6,8-trimethylquinoline. InChIKey: ZLLFZRRHKAPRNV-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 4-bromo-2,6,8-trimethylquinoline |
| InChIKey | ZLLFZRRHKAPRNV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C)Br)C |
Computed by PubChem (NCBI)