CAS 1070879-61-6 appears in our catalog under these names: 4-Bromo-2,7,8-trimethylquinoline, 95%, 4-Bromo-2,7,8-trimethylquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-bromo-2,7,8-trimethylquinoline (CAS 1070879-61-6) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 4-bromo-2,7,8-trimethylquinoline. InChIKey: FDEFLDIBSLKLEN-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 4-bromo-2,7,8-trimethylquinoline |
| InChIKey | FDEFLDIBSLKLEN-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=CC(=C2C=C1)Br)C)C |
Computed by PubChem (NCBI)