cas: 6450-57-3 — see every product listed under this CAS number, including other names
1-(2-Mesitylene)-1,3-butanedione, >96.0%(GC) (CAS 6450-57-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M1272-5G |
| cas | 6450-57-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 595.32 Pln | |
| TCI | 25g | 1908.22 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >96.0%(GC) |
1-(2,4,6-trimethylphenyl)butane-1,3-dione (CAS 6450-57-3) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)butane-1,3-dione. InChIKey: MBZZDUHWYNESIY-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)butane-1,3-dione |
| InChIKey | MBZZDUHWYNESIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)CC(=O)C)C |
Computed by PubChem (NCBI)