cas: 6450-57-3 — see every product listed under this CAS number, including other names
1-(2-Mesitylene)-1,3-butanedione, 98%, 98% (CAS 6450-57-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CUV-100mg |
| cas | 6450-57-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(2,4,6-trimethylphenyl)butane-1,3-dione (CAS 6450-57-3) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)butane-1,3-dione. InChIKey: MBZZDUHWYNESIY-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)butane-1,3-dione |
| InChIKey | MBZZDUHWYNESIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)CC(=O)C)C |
Computed by PubChem (NCBI)