cas: 958027-82-2 — see every product listed under this CAS number, including other names
1-(2-bromoethyl)-2,3-dichlorobenzene, 95%, 95% (CAS 958027-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BG2S-250mg |
| cas | 958027-82-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1408.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-bromoethyl)-2,3-dichlorobenzene (CAS 958027-82-2) is a chemical compound with the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. IUPAC name: 1-(2-bromoethyl)-2,3-dichlorobenzene. InChIKey: FDYYGZOWHGEICH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2 |
|---|---|
| Molecular weight | 253.95 g/mol |
| IUPAC name | 1-(2-bromoethyl)-2,3-dichlorobenzene |
| InChIKey | FDYYGZOWHGEICH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)CCBr |
Computed by PubChem (NCBI)