Products 39232-02-5

CAS 39232-02-5 is the registry number for 4-(2-Bromoethyl)-1,2-dichlorobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(2-bromoethyl)-1,2-dichlorobenzene (CAS 39232-02-5) is a chemical compound with the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. IUPAC name: 4-(2-bromoethyl)-1,2-dichlorobenzene. InChIKey: NZPXCNCZFYELLC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrCl2
Molecular weight253.95 g/mol
IUPAC name4-(2-bromoethyl)-1,2-dichlorobenzene
InChIKeyNZPXCNCZFYELLC-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CCBr)Cl)Cl

Computed by PubChem (NCBI)