CAS 20444-01-3 is the registry number for 1-(1-Bromoethyl)-2,4-dichlorobenzene, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1-(1-bromoethyl)-2,4-dichlorobenzene (CAS 20444-01-3) is a chemical compound with the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. IUPAC name: 1-(1-bromoethyl)-2,4-dichlorobenzene. InChIKey: YXQINLRLOBXZTF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2 |
|---|---|
| Molecular weight | 253.95 g/mol |
| IUPAC name | 1-(1-bromoethyl)-2,4-dichlorobenzene |
| InChIKey | YXQINLRLOBXZTF-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)