Products 98437-27-5
CAS 98437-27-5 appears in our catalog under these names: 2-(1-Bromoethyl)-1,4-dichlorobenzene, 95%, 2-(1-Bromoethyl)-1,4-dichlorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(1-bromoethyl)-1,4-dichlorobenzene (CAS 98437-27-5) is a chemical compound with the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. IUPAC name: 2-(1-bromoethyl)-1,4-dichlorobenzene. InChIKey: KCQSVHIDXSWAKF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2 |
|---|---|
| Molecular weight | 253.95 g/mol |
| IUPAC name | 2-(1-bromoethyl)-1,4-dichlorobenzene |
| InChIKey | KCQSVHIDXSWAKF-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)