CAS 192702-37-7 appears in our catalog under these names: 4-(1-Bromoethyl)-1,2-dichlorobenzene, 95+%, 4-(1-Bromoethyl)-1,2-dichlorobenzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(1-bromoethyl)-1,2-dichlorobenzene (CAS 192702-37-7) is a chemical compound with the molecular formula C8H7BrCl2 and a molecular weight of 253.95 g/mol. IUPAC name: 4-(1-bromoethyl)-1,2-dichlorobenzene. InChIKey: LNEQRCLPPPXKGY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrCl2 |
|---|---|
| Molecular weight | 253.95 g/mol |
| IUPAC name | 4-(1-bromoethyl)-1,2-dichlorobenzene |
| InChIKey | LNEQRCLPPPXKGY-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)