cas: 1099631-80-7 — see every product listed under this CAS number, including other names
1-(2-methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 95% (CAS 1099631-80-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C4A3-100mg |
| cas | 1099631-80-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1235.60 Pln | |
| Chemat | 250mg | 1744.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(2-methylphenyl)triazole-4-carboxylic acid (CAS 1099631-80-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-(2-methylphenyl)triazole-4-carboxylic acid. InChIKey: DAYJQFRBEKQYDR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-(2-methylphenyl)triazole-4-carboxylic acid |
| InChIKey | DAYJQFRBEKQYDR-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)