Products 1341694-71-0
CAS 1341694-71-0 appears in our catalog under these names: 2-(3-Pyridylmethyl)pyrazole-3-carboxylic acid, 95%, 2-(3-Pyridylmethyl)pyrazole-3-carboxylic acid, 98%, 2-(3-Pyridylmethyl)pyrazole-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 500mg.
2-(pyridin-3-ylmethyl)pyrazole-3-carboxylic acid (CAS 1341694-71-0) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 2-(pyridin-3-ylmethyl)pyrazole-3-carboxylic acid. InChIKey: STORXNOWDYHZRM-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2-(pyridin-3-ylmethyl)pyrazole-3-carboxylic acid |
| InChIKey | STORXNOWDYHZRM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)CN2C(=CC=N2)C(=O)O |
Computed by PubChem (NCBI)