CAS 1099631-80-7 appears in our catalog under these names: 1-(2-Methylphenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(2-Methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 1-(2-methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
1-(2-methylphenyl)triazole-4-carboxylic acid (CAS 1099631-80-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-(2-methylphenyl)triazole-4-carboxylic acid. InChIKey: DAYJQFRBEKQYDR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-(2-methylphenyl)triazole-4-carboxylic acid |
| InChIKey | DAYJQFRBEKQYDR-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)