CAS 1368811-52-2 appears in our catalog under these names: 2-(3-Phenyl-1h-1,2,4-triazol-1-yl)acetic acid, 95%, 2-(3-Phenyl-1H-1,2,4-triazol-1-yl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
2-(3-phenyl-1,2,4-triazol-1-yl)acetic acid (CAS 1368811-52-2) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 2-(3-phenyl-1,2,4-triazol-1-yl)acetic acid. InChIKey: WXHAAPOMKCDXFA-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2-(3-phenyl-1,2,4-triazol-1-yl)acetic acid |
| InChIKey | WXHAAPOMKCDXFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN(C=N2)CC(=O)O |
Computed by PubChem (NCBI)