CAS 944901-55-7 appears in our catalog under these names: 1-(3-Methylphenyl)-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(3-Methylphenyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g.
1-(3-methylphenyl)triazole-4-carboxylic acid (CAS 944901-55-7) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-(3-methylphenyl)triazole-4-carboxylic acid. InChIKey: SLGDDWABRNAGHM-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-(3-methylphenyl)triazole-4-carboxylic acid |
| InChIKey | SLGDDWABRNAGHM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C=C(N=N2)C(=O)O |
Computed by PubChem (NCBI)