cas: 677022-27-4 — see every product listed under this CAS number, including other names
1-(3',5'-Dimethyl-[1,1'-biphenyl]-4-yl)ethanone, ≥95%, ≥95% (CAS 677022-27-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132PV0-1g |
| cas | 677022-27-4 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4048.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-[4-(3,5-dimethylphenyl)phenyl]ethanone (CAS 677022-27-4) is a chemical compound with the molecular formula C16H16O and a molecular weight of 224.30 g/mol. IUPAC name: 1-[4-(3,5-dimethylphenyl)phenyl]ethanone. InChIKey: UBMOPBKMERPGRG-UHFFFAOYSA-N.
| Molecular formula | C16H16O |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 1-[4-(3,5-dimethylphenyl)phenyl]ethanone |
| InChIKey | UBMOPBKMERPGRG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)C(=O)C)C |
Computed by PubChem (NCBI)