cas: 19250-09-0 — see every product listed under this CAS number, including other names
1-(3,4-Dichlorophenyl)thiourea 98+% (CAS 19250-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A187212-1g |
| cas | 19250-09-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 25g | 409.31 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A187212 |
(3,4-dichlorophenyl)thiourea (CAS 19250-09-0) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: (3,4-dichlorophenyl)thiourea. InChIKey: CCNCITSJXCSXJY-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (3,4-dichlorophenyl)thiourea |
| InChIKey | CCNCITSJXCSXJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=S)N)Cl)Cl |
Computed by PubChem (NCBI)