cas: 19250-09-0 — see every product listed under this CAS number, including other names
1-(3,4-Dichlorophenyl)-2-thiourea, 95% (CAS 19250-09-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018546-1G |
| cas | 19250-09-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 1450.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(3,4-dichlorophenyl)thiourea (CAS 19250-09-0) is a chemical compound with the molecular formula C7H6Cl2N2S and a molecular weight of 221.11 g/mol. IUPAC name: (3,4-dichlorophenyl)thiourea. InChIKey: CCNCITSJXCSXJY-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2S |
|---|---|
| Molecular weight | 221.11 g/mol |
| IUPAC name | (3,4-dichlorophenyl)thiourea |
| InChIKey | CCNCITSJXCSXJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=S)N)Cl)Cl |
Computed by PubChem (NCBI)