cas: 127257-87-8 — see every product listed under this CAS number, including other names
1-(3-Bromophenyl)-2,5-dimethyl-1H-pyrrole (CAS 127257-87-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036138-5G |
| cas | 127257-87-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1783.76 Pln | |
| Fluorochem | 10g | 2976.05 Pln |
| delivery time | 3-4 weeks |
|---|
1-(3-bromophenyl)-2,5-dimethylpyrrole (CAS 127257-87-8) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 1-(3-bromophenyl)-2,5-dimethylpyrrole. InChIKey: DRFJJKOQBRMRCL-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,5-dimethylpyrrole |
| InChIKey | DRFJJKOQBRMRCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC=C2)Br)C |
Computed by PubChem (NCBI)