cas: 944523-21-1 — see every product listed under this CAS number, including other names
1-(3-Chloro-4-methylphenyl)-2,5-dimethyl-1H-pyrrole (CAS 944523-21-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F629897-5G |
| cas | 944523-21-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1388.07 Pln | |
| Fluorochem | 10g | 2314.83 Pln |
| delivery time | 3-4 weeks |
|---|
1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrole (CAS 944523-21-1) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrole. InChIKey: DOHLZNDWJYOVHB-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)-2,5-dimethylpyrrole |
| InChIKey | DOHLZNDWJYOVHB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=CC=C2C)C)Cl |
Computed by PubChem (NCBI)