cas: 886497-11-6 — see every product listed under this CAS number, including other names
1-(3-Chloro-5-(trifluoromethyl)phenyl)ethanone, 97%(GC-MS),RG, 97%(GC-MS),RG (CAS 886497-11-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143NO-1g |
| cas | 886497-11-6 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 25g | 2070.80 Pln |
| purity | 97%(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-[3-chloro-5-(trifluoromethyl)phenyl]ethanone (CAS 886497-11-6) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 1-[3-chloro-5-(trifluoromethyl)phenyl]ethanone. InChIKey: HRGMIFUPRXVREB-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 1-[3-chloro-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | HRGMIFUPRXVREB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)