Products 261952-09-4

CAS 261952-09-4 appears in our catalog under these names: 3-Methyl-5-(trifluoromethyl)benzoyl chloride, 95%, 3-Methyl-5-(trifluoromethyl)benzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-methyl-5-(trifluoromethyl)benzoyl chloride (CAS 261952-09-4) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 3-methyl-5-(trifluoromethyl)benzoyl chloride. InChIKey: STYLTOJEHPKJDF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClF3O
Molecular weight222.59 g/mol
IUPAC name3-methyl-5-(trifluoromethyl)benzoyl chloride
InChIKeySTYLTOJEHPKJDF-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)C(F)(F)F)C(=O)Cl

Computed by PubChem (NCBI)