CAS 79611-55-5 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,1,1-trifluoro-2-propanone, 95%, 3-(4-Chlorophenyl)-1,1,1-trifluoropropan-2-one 95%, 3-(4-Chlorophenyl)-1,1,1-trifluoro-2-propanone, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-one (CAS 79611-55-5) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-one. InChIKey: FKTNTKPCXIKFBJ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,1,1-trifluoropropan-2-one |
| InChIKey | FKTNTKPCXIKFBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)