CAS 261952-11-8 appears in our catalog under these names: 4-Methyl-3-(trifluoromethyl)benzoyl chloride, 95%, 4-Methyl-3-(trifluoromethyl)benzoylchloride 98%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
4-methyl-3-(trifluoromethyl)benzoyl chloride (CAS 261952-11-8) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 4-methyl-3-(trifluoromethyl)benzoyl chloride. InChIKey: KKGAVDJJVMSTSV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 4-methyl-3-(trifluoromethyl)benzoyl chloride |
| InChIKey | KKGAVDJJVMSTSV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)