CAS 129322-82-3 is the registry number for 2'-Chloro-3'-(trifluoromethyl)acetophenone, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[2-chloro-3-(trifluoromethyl)phenyl]ethanone (CAS 129322-82-3) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 1-[2-chloro-3-(trifluoromethyl)phenyl]ethanone. InChIKey: IQGXHYRICLUDTC-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 1-[2-chloro-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | IQGXHYRICLUDTC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)