cas: 58212-15-0 — see every product listed under this CAS number, including other names
1-(3-Hydroxyphenyl)pyrrolidin-2-one, 95%, 95% (CAS 58212-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EYUZ-100mg |
| cas | 58212-15-0 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1619.60 Pln | |
| Chemat | 5g | 4542.80 Pln | |
| Chemat | 10g | 6678.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-hydroxyphenyl)pyrrolidin-2-one (CAS 58212-15-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 1-(3-hydroxyphenyl)pyrrolidin-2-one. InChIKey: YZVOLCQVEKXPHT-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)pyrrolidin-2-one |
| InChIKey | YZVOLCQVEKXPHT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)