cas: 87394-48-7 — see every product listed under this CAS number, including other names
1-(3-Nitropyridin-2-yl)piperazine, 98%, 98% (CAS 87394-48-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115JVA-100mg |
| cas | 87394-48-7 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(3-nitro-2-pyridinyl)piperazine (CAS 87394-48-7) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 1-(3-nitro-2-pyridinyl)piperazine. InChIKey: HSAKGWZDXDRYTB-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 1-(3-nitro-2-pyridinyl)piperazine |
| InChIKey | HSAKGWZDXDRYTB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=C(C=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)