CAS 656830-86-3 is the registry number for 2-Amino-5-(3-hydroxypropyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-(3-hydroxypropyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (CAS 656830-86-3) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 2-amino-5-(3-hydroxypropyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one. InChIKey: LEYPCDQXZSSCNQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 2-amino-5-(3-hydroxypropyl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | LEYPCDQXZSSCNQ-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)N=C(NC2=O)N)CCCO |
Computed by PubChem (NCBI)