CAS 2270905-55-8 is the registry number for Methyl 2,5-dimethyl-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (CAS 2270905-55-8) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: methyl 2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: FYBRCZRGMHDEHO-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | methyl 2,5-dimethyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | FYBRCZRGMHDEHO-UHFFFAOYSA-N |
| SMILES | CC1=C(CN2C(=NC(=N2)C)N1)C(=O)OC |
Computed by PubChem (NCBI)