CAS 1250099-01-4 appears in our catalog under these names: 6-(5-Amino-1h-1,2,4-triazol-3-yl)cyclohex-3-ene-1-carboxylic acid, 95%, 6-(5-Amino-1H-1,2,4-triazol-3-yl)cyclohex-3-enecarboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
6-(3-amino-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid (CAS 1250099-01-4) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 6-(3-amino-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid. InChIKey: NKUGEHQZWWVAME-UHFFFAOYSA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 6-(3-amino-1H-1,2,4-triazol-5-yl)cyclohex-3-ene-1-carboxylic acid |
| InChIKey | NKUGEHQZWWVAME-UHFFFAOYSA-N |
| SMILES | C1C=CCC(C1C2=NC(=NN2)N)C(=O)O |
Computed by PubChem (NCBI)