CAS 1403949-10-9 is the registry number for (S)-2-(1-Amino-3-hydroxypropyl)pyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1S)-1-amino-3-hydroxypropyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 1403949-10-9) is a chemical compound with the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. IUPAC name: 2-[(1S)-1-amino-3-hydroxypropyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: AFRWAUBJFAGGFS-LURJTMIESA-N.
| Molecular formula | C9H12N4O2 |
|---|---|
| Molecular weight | 208.22 g/mol |
| IUPAC name | 2-[(1S)-1-amino-3-hydroxypropyl]-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | AFRWAUBJFAGGFS-LURJTMIESA-N |
| SMILES | C1=CN2C(=C1)C(=O)NC(=N2)[C@H](CCO)N |
Computed by PubChem (NCBI)