cas: 161871-65-4 — see every product listed under this CAS number, including other names
1-(3-Nitropyridin-4-yl)ethanone, 97%, 97% (CAS 161871-65-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112VX8-100mg |
| cas | 161871-65-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 410.00 Pln | |
| Chemat | 1g | 755.60 Pln | |
| Chemat | 5g | 2838.80 Pln | |
| Chemat | 10g | 4739.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(3-nitro-4-pyridinyl)ethanone (CAS 161871-65-4) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: 1-(3-nitro-4-pyridinyl)ethanone. InChIKey: WJBPEUKZXRFJDM-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 1-(3-nitro-4-pyridinyl)ethanone |
| InChIKey | WJBPEUKZXRFJDM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=NC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)