cas: 14347-05-8 — see every product listed under this CAS number, including other names
1-(4-(Benzyloxy)-3-nitrophenyl)ethanone, 95%, 95% (CAS 14347-05-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117UW9-1g |
| cas | 14347-05-8 |
| size | 1g |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 198.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(3-nitro-4-phenylmethoxyphenyl)ethanone (CAS 14347-05-8) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 1-(3-nitro-4-phenylmethoxyphenyl)ethanone. InChIKey: OWKGFSOHSDMRJL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 1-(3-nitro-4-phenylmethoxyphenyl)ethanone |
| InChIKey | OWKGFSOHSDMRJL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)