Products 34425-86-0

CAS 34425-86-0 is the registry number for 2-[(4-Methoxybenzoyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-[(4-methoxybenzoyl)amino]benzoic acid (CAS 34425-86-0) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 2-[(4-methoxybenzoyl)amino]benzoic acid. InChIKey: FWDOQXWBHGKWRK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO4
Molecular weight271.27 g/mol
IUPAC name2-[(4-methoxybenzoyl)amino]benzoic acid
InChIKeyFWDOQXWBHGKWRK-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C(=O)NC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)