Products 5330-71-2
CAS 5330-71-2 appears in our catalog under these names: 4-(Benzyloxycarbonylamino)benzoic acid, 95%, Cbz-4-ABCbz-OH 95%, 4-(((Benzyloxy)carbonyl)amino)benzoic acid, 95%, 95%, 4-(BENZYLOXYCARBONYLAMINO)BENZOIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 10g.
4-(phenylmethoxycarbonylamino)benzoic acid (CAS 5330-71-2) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 4-(phenylmethoxycarbonylamino)benzoic acid. InChIKey: XRKLFEVNZWRMCT-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 4-(phenylmethoxycarbonylamino)benzoic acid |
| InChIKey | XRKLFEVNZWRMCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(((Benzyloxy)carbonyl)amino)benzoic acid, 4-(benzyloxycarbonylamino)benzoic acid, 4-{[(benzyloxy)carbonyl]amino}benzoic acid, 4-(Cbz-amino)benzoic acid, 4-(phenylmethoxycarbonylamino)benzoic acid, Benzoic acid, 4-[[(phenylmethoxy)carbonyl]amino]- (9CI), Z-(4)Abz-OH, Cbz-4-ABCbz-OH, Oprea1_655434, XRKLFEVNZWRMCT-UHFFFAOYSA-N