Products 157396-29-7
CAS 157396-29-7 appears in our catalog under these names: (4-Phenoxy-benzoylamino)-acetic acid, 95%, 2-((4-Phenoxyphenyl)formamido)acetic acid, 95%, (4-Phenoxy-benzoylamino)-acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 0,5g, 5mg, 25mg, 25g.
2-[(4-phenoxybenzoyl)amino]acetic acid (CAS 157396-29-7) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 2-[(4-phenoxybenzoyl)amino]acetic acid. InChIKey: RWPWRWSNTGJXQW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 2-[(4-phenoxybenzoyl)amino]acetic acid |
| InChIKey | RWPWRWSNTGJXQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)