CAS 4446-60-0 is the registry number for 4,5,6,7-Tetrahydro-1h-indazol-3-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylic acid (CAS 4446-60-0) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylic acid. InChIKey: SWCAUWOTAMMLMS-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 2,6-dimethyl-4-phenylpyridine-3,5-dicarboxylic acid |
| InChIKey | SWCAUWOTAMMLMS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)O)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)