cas: 4495-66-3 — see every product listed under this CAS number, including other names
1-(4-(Benzyloxy)phenyl)propan-1-one 98% (CAS 4495-66-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A673722-5g |
| cas | 4495-66-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 704.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A673722 |
1-(4-phenylmethoxyphenyl)propan-1-one (CAS 4495-66-3) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 1-(4-phenylmethoxyphenyl)propan-1-one. InChIKey: IKFGSOJYHVTNDV-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(4-phenylmethoxyphenyl)propan-1-one |
| InChIKey | IKFGSOJYHVTNDV-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)