cas: 4495-66-3 — see every product listed under this CAS number, including other names
4-Benzyloxypropiophenone (CAS 4495-66-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F099173-1G |
| cas | 4495-66-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 331.15 Pln | |
| Fluorochem | 50g | 518.59 Pln | |
| Fluorochem | 100g | 799.74 Pln |
| delivery time | 2-3 weeks |
|---|
1-(4-phenylmethoxyphenyl)propan-1-one (CAS 4495-66-3) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 1-(4-phenylmethoxyphenyl)propan-1-one. InChIKey: IKFGSOJYHVTNDV-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(4-phenylmethoxyphenyl)propan-1-one |
| InChIKey | IKFGSOJYHVTNDV-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)