cas: 21886-62-4 — see every product listed under this CAS number, including other names
1-(4-(tert-Butyl)phenyl)-2-chloroethanone 97% (CAS 21886-62-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A119790-1g |
| cas | 21886-62-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 25g | 5170.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A119790 |
1-(4-tert-butylphenyl)-2-chloroethanone (CAS 21886-62-4) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-chloroethanone. InChIKey: LTHPBRNHHJIQME-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-chloroethanone |
| InChIKey | LTHPBRNHHJIQME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CCl |
Computed by PubChem (NCBI)