cas: 21886-62-4 — see every product listed under this CAS number, including other names
1-(4-tert-Butylphenyl)-2-chloroethanone (CAS 21886-62-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011112-1G |
| cas | 21886-62-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 299.91 Pln |
| delivery time | 2-3 weeks |
|---|
1-(4-tert-butylphenyl)-2-chloroethanone (CAS 21886-62-4) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 1-(4-tert-butylphenyl)-2-chloroethanone. InChIKey: LTHPBRNHHJIQME-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 1-(4-tert-butylphenyl)-2-chloroethanone |
| InChIKey | LTHPBRNHHJIQME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CCl |
Computed by PubChem (NCBI)