1-(4-Aminophenyl)pyrimidine-2,4(1H,3H)-dione, 97%
cas: 1797409-11-0 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)pyrimidine-2,4(1H,3H)-dione, 97% (CAS 1797409-11-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A289070-250mg |
| cas | 1797409-11-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1972.38 Pln | |
| BLDpharm | 100mg | 480.97 Pln | |
| BLDpharm | 250mg | 758.65 Pln | |
| BLDpharm | 1g | 1936.01 Pln | |
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 1202.00 Pln | |
| Chemat | 500mg | 1955.60 Pln | |
| Fluorochem | 100mg | 1164.19 Pln | |
| Fluorochem | 250mg | 2231.52 Pln | |
| Fluorochem | 500mg | 3616.45 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-aminophenyl)pyrimidine-2,4-dione (CAS 1797409-11-0) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-(4-aminophenyl)pyrimidine-2,4-dione. InChIKey: QAHLJTUTRRABTE-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-(4-aminophenyl)pyrimidine-2,4-dione |
| InChIKey | QAHLJTUTRRABTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C=CC(=O)NC2=O |
Computed by PubChem (NCBI)