cas: 166525-97-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-chlorophenyl)propan-1-one, 97%, 97% (CAS 166525-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WT2-100mg |
| cas | 166525-97-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 837.20 Pln | |
| Chemat | 250mg | 1365.20 Pln | |
| Chemat | 1g | 3203.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-2-chlorophenyl)propan-1-one (CAS 166525-97-9) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 1-(4-bromo-2-chlorophenyl)propan-1-one. InChIKey: HTAIAXBXKUEXHB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 1-(4-bromo-2-chlorophenyl)propan-1-one |
| InChIKey | HTAIAXBXKUEXHB-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)