CAS 87010-95-5 is the registry number for 1-(4-Bromo-phenyl)-2-chloro-propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
1-(4-bromophenyl)-2-chloropropan-1-one (CAS 87010-95-5) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 1-(4-bromophenyl)-2-chloropropan-1-one. InChIKey: XWLIUMZBOPOTCS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-chloropropan-1-one |
| InChIKey | XWLIUMZBOPOTCS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)