CAS 42762-86-7 appears in our catalog under these names: 2-Bromo-3-phenylpropanoyl chloride, tech grade, 90%, 2-Bromo-3-phenylpropanoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
2-bromo-3-phenylpropanoyl chloride (CAS 42762-86-7) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 2-bromo-3-phenylpropanoyl chloride. InChIKey: PLTQBSSKEGUDLB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 2-bromo-3-phenylpropanoyl chloride |
| InChIKey | PLTQBSSKEGUDLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)Cl)Br |
Computed by PubChem (NCBI)