Products 1094787-56-0
CAS 1094787-56-0 appears in our catalog under these names: 1-(2-Bromophenyl)-3-chloropropan-2-one, 95%, 1-(2-Bromophenyl)-3-chloropropan-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-(2-bromophenyl)-3-chloropropan-2-one (CAS 1094787-56-0) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 1-(2-bromophenyl)-3-chloropropan-2-one. InChIKey: IAMJCEZZJGGUOB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 1-(2-bromophenyl)-3-chloropropan-2-one |
| InChIKey | IAMJCEZZJGGUOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)CCl)Br |
Computed by PubChem (NCBI)