Products 90725-40-9
CAS 90725-40-9 appears in our catalog under these names: 3-(2-Bromophenyl)propanoyl chloride, 95%, 3-(2-Bromophenyl)propanoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(2-bromophenyl)propanoyl chloride (CAS 90725-40-9) is a chemical compound with the molecular formula C9H8BrClO and a molecular weight of 247.51 g/mol. IUPAC name: 3-(2-bromophenyl)propanoyl chloride. InChIKey: GGFPFUUJHMSPJS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO |
|---|---|
| Molecular weight | 247.51 g/mol |
| IUPAC name | 3-(2-bromophenyl)propanoyl chloride |
| InChIKey | GGFPFUUJHMSPJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCC(=O)Cl)Br |
Computed by PubChem (NCBI)