cas: 1020253-81-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-hydroxy-5-methylphenyl)ethanone 95% (CAS 1020253-81-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A369496-250mg |
| cas | 1020253-81-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1310.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A369496 |
1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone (CAS 1020253-81-9) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone. InChIKey: BPQABGQSVOUODJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone |
| InChIKey | BPQABGQSVOUODJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)O)C(=O)C |
Computed by PubChem (NCBI)