cas: 1176645-11-6 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-methylphenyl)-3,5-dimethyl-1H-pyrazole, 98% (CAS 1176645-11-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1634534-25g |
| cas | 1176645-11-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 38661.28 Pln | |
| AmBeed | 10g | 19704.16 Pln | |
| AmBeed | 5g | 11579.68 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole (CAS 1176645-11-6) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole. InChIKey: LHHSYEPECSEEET-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)-3,5-dimethylpyrazole |
| InChIKey | LHHSYEPECSEEET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=C(C=C2)Br)C)C |
Computed by PubChem (NCBI)