Products 1176493-60-9
CAS 1176493-60-9 appears in our catalog under these names: 1-(3-Bromo-4-methylphenyl)-3,5-dimethyl-1h-pyrazole, 95%, 1-(3-Bromo-4-methylphenyl)-3,5-dimethyl-1H-pyrazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(3-bromo-4-methylphenyl)-3,5-dimethylpyrazole (CAS 1176493-60-9) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 1-(3-bromo-4-methylphenyl)-3,5-dimethylpyrazole. InChIKey: VRXHTEJKGUBVIA-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 1-(3-bromo-4-methylphenyl)-3,5-dimethylpyrazole |
| InChIKey | VRXHTEJKGUBVIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=CC(=N2)C)C)Br |
Computed by PubChem (NCBI)