Products 881002-28-4
CAS 881002-28-4 is the registry number for 4-Bromo-2-(piperidin-1-yl)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 25g, 5g.
4-bromo-2-piperidin-1-ylbenzonitrile (CAS 881002-28-4) is a chemical compound with the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. IUPAC name: 4-bromo-2-piperidin-1-ylbenzonitrile. InChIKey: AAFDFZZJMSSGFL-UHFFFAOYSA-N.
| Molecular formula | C12H13BrN2 |
|---|---|
| Molecular weight | 265.15 g/mol |
| IUPAC name | 4-bromo-2-piperidin-1-ylbenzonitrile |
| InChIKey | AAFDFZZJMSSGFL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=CC(=C2)Br)C#N |
Computed by PubChem (NCBI)